About 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine
7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine (PubChem CID 62202889) has the molecular formula C14H15BrN2
and a molecular weight of 291.19 g/mol. Its IUPAC name is 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine.
Molecular Properties
| Compound Name | 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
| PubChem CID | 62202889 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
| SMILES | CNc1c2c(nc3c(C)cc(Br)cc13)CCC2 |
| InChI | InChI=1S/C14H15BrN2/c1-8-6-9(15)7-11-13(8)17-12-5-3-4-10(12)14(11)16-2/h6-7H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | UEAYYJGKBVXVQZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine?
The IUPAC name of 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine (CID 62202889) is 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine.
What is the SMILES notation for 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine?
The canonical SMILES for 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine is CNc1c2c(nc3c(C)cc(Br)cc13)CCC2.
What is the InChIKey of 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine?
The InChIKey is UEAYYJGKBVXVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2/c1-8-6-9(15)7-11-13(8)17-12-5-3-4-10(12)14(11)16-2/h6-7H,3-5H2,1-2H3,(H,16,17).
What are the key properties of 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine?
7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine has a molecular weight of 291.19 g/mol, XLogP of 3.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N,5-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine is sourced from PubChem (CID 62202889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).