About 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene
1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene (PubChem CID 622047) has the molecular formula C6BrClF4
and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene |
| PubChem CID | 622047 |
| Molecular Formula | C6BrClF4 |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 261.88 |
| IUPAC Name | 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(Br)c(F)c(F)c1Cl |
| InChI | InChI=1S/C6BrClF4/c7-1-3(9)5(11)2(8)6(12)4(1)10 |
| InChIKey | NBLNPUIBUYHFAT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene?
The IUPAC name of 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene (CID 622047) is 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene.
What is the SMILES notation for 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene?
The canonical SMILES for 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene is Fc1c(F)c(Br)c(F)c(F)c1Cl.
What is the InChIKey of 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene?
The InChIKey is NBLNPUIBUYHFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6BrClF4/c7-1-3(9)5(11)2(8)6(12)4(1)10.
What are the key properties of 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene?
1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene has a molecular weight of 263.41 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-chloro-2,3,5,6-tetrafluorobenzene is sourced from PubChem (CID 622047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).