About 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline
3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline (PubChem CID 62204818) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline.
Molecular Properties
| Compound Name | 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline |
| PubChem CID | 62204818 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-7-8-15(17)12(2)16(11)21(19,20)18-9-13-5-3-4-6-14(13)10-18/h3-8H,9-10,17H2,1-2H3 |
| InChIKey | NYJSHHDTBQSXHN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline?
The IUPAC name of 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline (CID 62204818) is 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline.
What is the SMILES notation for 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline?
The canonical SMILES for 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline is Cc1ccc(N)c(C)c1S(=O)(=O)N1Cc2ccccc2C1.
What is the InChIKey of 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline?
The InChIKey is NYJSHHDTBQSXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-11-7-8-15(17)12(2)16(11)21(19,20)18-9-13-5-3-4-6-14(13)10-18/h3-8H,9-10,17H2,1-2H3.
What are the key properties of 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline?
3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline has a molecular weight of 302.40 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydroisoindol-2-ylsulfonyl)-2,4-dimethylaniline is sourced from PubChem (CID 62204818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).