C16H13FN2 — CID 62205553
3-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorobenzonitrile (PubChem CID 62205553) has the molecular formula C16H13FN2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorobenzonitrile.
| Compound Name | 3-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 62205553 |
| Molecular Formula | C16H13FN2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-ylmethyl)-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C16H13FN2/c17-16-6-5-12(8-18)7-15(16)11-19-9-13-3-1-2-4-14(13)10-19/h1-7H,9-11H2 |
| InChIKey | NVWVMNCTAQACMJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |