C14H20ClNOS — CID 62205766
1-(5-chlorothiophen-2-yl)-2-(4-propylpiperidin-1-yl)ethanone (PubChem CID 62205766) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(4-propylpiperidin-1-yl)ethanone.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(4-propylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 62205766 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(4-propylpiperidin-1-yl)ethanone |
| SMILES | CCCC1CCN(CC(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H20ClNOS/c1-2-3-11-6-8-16(9-7-11)10-12(17)13-4-5-14(15)18-13/h4-5,11H,2-3,6-10H2,1H3 |
| InChIKey | KZSGBLCAFNQOPP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |