C14H22N2 — CID 62205880
2-(1,3-dihydroisoindol-2-yl)-3,3-dimethylbutan-1-amine (PubChem CID 62205880) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)-3,3-dimethylbutan-1-amine.
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62205880 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)C(CN)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H22N2/c1-14(2,3)13(8-15)16-9-11-6-4-5-7-12(11)10-16/h4-7,13H,8-10,15H2,1-3H3 |
| InChIKey | VMAKDCNKXDGGGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |