5-(2-hydroxyethoxy)furan-2-carboxylic acid

C7H8O5 — CID 62206874

IUPAC5-(2-hydroxyethoxy)furan-2-carboxylic acid
SMILESO=C(O)c1ccc(OCCO)o1
InChIInChI=1S/C7H8O5/c8-3-4-11-6-2-1-5(12-6)7(9)10/h1-2,8H,3-4H2,(H,9,10)
InChIKeyVQALUAOGNXVNBS-UHFFFAOYSA-N
MW172.14 g/mol
LogP0.35
Rot. Bonds4

About 5-(2-hydroxyethoxy)furan-2-carboxylic acid

5-(2-hydroxyethoxy)furan-2-carboxylic acid (PubChem CID 62206874) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is 5-(2-hydroxyethoxy)furan-2-carboxylic acid.

Molecular Properties

Compound Name5-(2-hydroxyethoxy)furan-2-carboxylic acid
PubChem CID62206874
Molecular FormulaC7H8O5
Molecular Weight172.14 g/mol
Exact Mass172.04
IUPAC Name5-(2-hydroxyethoxy)furan-2-carboxylic acid
SMILESO=C(O)c1ccc(OCCO)o1
InChIInChI=1S/C7H8O5/c8-3-4-11-6-2-1-5(12-6)7(9)10/h1-2,8H,3-4H2,(H,9,10)
InChIKeyVQALUAOGNXVNBS-UHFFFAOYSA-N
XLogP0.35
TPSA79.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.14
LogP ≤ 50.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(2-hydroxyethoxy)furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-(3-methoxypropoxy)furan-2-carboxylic acid
CID 62206697
5-(2-phenoxyethoxy)furan-2-carboxylic acid
CID 62205472
5-(2-ethoxyethoxy)furan-2-carboxylic acid
CID 62205469
5-(3,3,3-trifluoropropoxy)furan-2-carboxylic acid
CID 82954819
5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]furan-2-carboxylic acid
CID 104560434
5-(2-propan-2-yloxyethoxy)furan-2-carboxylic acid
CID 62205827
sodium;hydride;5-tetradecoxyfuran-2-carboxylic acid
CID 173446967
5-undec-10-enoxyfuran-2-carboxylic acid
CID 21327076
5-(cyclohex-2-en-1-ylmethoxy)furan-2-carboxylic acid
CID 151251955
dichloromethane;propan-2-yl 5-tetradecoxyfuran-2-carboxylate;5-tetradecoxyfuran-2-carboxylic acid
CID 157100187
furan-2,5-dicarboxylic acid;indigane
CID 174700126
5-[2-(hydroxymethyl)phenoxy]furan-2-carboxylic acid
CID 55244838

Frequently Asked Questions

What is the IUPAC name of 5-(2-hydroxyethoxy)furan-2-carboxylic acid?
The IUPAC name of 5-(2-hydroxyethoxy)furan-2-carboxylic acid (CID 62206874) is 5-(2-hydroxyethoxy)furan-2-carboxylic acid.
What is the SMILES notation for 5-(2-hydroxyethoxy)furan-2-carboxylic acid?
The canonical SMILES for 5-(2-hydroxyethoxy)furan-2-carboxylic acid is O=C(O)c1ccc(OCCO)o1.
What is the InChIKey of 5-(2-hydroxyethoxy)furan-2-carboxylic acid?
The InChIKey is VQALUAOGNXVNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5/c8-3-4-11-6-2-1-5(12-6)7(9)10/h1-2,8H,3-4H2,(H,9,10).
What are the key properties of 5-(2-hydroxyethoxy)furan-2-carboxylic acid?
5-(2-hydroxyethoxy)furan-2-carboxylic acid has a molecular weight of 172.14 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethoxy)furan-2-carboxylic acid is sourced from PubChem (CID 62206874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).