C11H12N4S — CID 62206965
3-(1,3-dihydroisoindol-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 62206965) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62206965 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(N2Cc3ccccc3C2)n[nH]c1=S |
| InChI | InChI=1S/C11H12N4S/c1-14-10(12-13-11(14)16)15-6-8-4-2-3-5-9(8)7-15/h2-5H,6-7H2,1H3,(H,13,16) |
| InChIKey | BTWLLGXBFHJYPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|