C9H11NO5S — CID 62207067
5-(1,1-dioxo-1,4-thiazinan-4-yl)furan-2-carboxylic acid (PubChem CID 62207067) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is 5-(1,1-dioxo-1,4-thiazinan-4-yl)furan-2-carboxylic acid.
| Compound Name | 5-(1,1-dioxo-1,4-thiazinan-4-yl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62207067 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-(1,1-dioxo-1,4-thiazinan-4-yl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCS(=O)(=O)CC2)o1 |
| InChI | InChI=1S/C9H11NO5S/c11-9(12)7-1-2-8(15-7)10-3-5-16(13,14)6-4-10/h1-2H,3-6H2,(H,11,12) |
| InChIKey | MGUHXSTTXRHWMN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |