About 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine
5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine (PubChem CID 62207142) has the molecular formula C17H20N4
and a molecular weight of 280.38 g/mol. Its IUPAC name is 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine |
| PubChem CID | 62207142 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine |
| SMILES | CCNc1ccc(Cn2cnc3cc(C)c(C)cc32)cn1 |
| InChI | InChI=1S/C17H20N4/c1-4-18-17-6-5-14(9-19-17)10-21-11-20-15-7-12(2)13(3)8-16(15)21/h5-9,11H,4,10H2,1-3H3,(H,18,19) |
| InChIKey | PKJICZFSODZOGB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine?
The IUPAC name of 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine (CID 62207142) is 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine.
What is the SMILES notation for 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine?
The canonical SMILES for 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine is CCNc1ccc(Cn2cnc3cc(C)c(C)cc32)cn1.
What is the InChIKey of 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine?
The InChIKey is PKJICZFSODZOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c1-4-18-17-6-5-14(9-19-17)10-21-11-20-15-7-12(2)13(3)8-16(15)21/h5-9,11H,4,10H2,1-3H3,(H,18,19).
What are the key properties of 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine?
5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine has a molecular weight of 280.38 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5,6-dimethylbenzimidazol-1-yl)methyl]-N-ethylpyridin-2-amine is sourced from PubChem (CID 62207142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).