C17H23N3 — CID 62209613
5-[(N,2-dimethylanilino)methyl]-N-propylpyridin-2-amine (PubChem CID 62209613) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-[(N,2-dimethylanilino)methyl]-N-propylpyridin-2-amine.
| Compound Name | 5-[(N,2-dimethylanilino)methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62209613 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-[(N,2-dimethylanilino)methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(CN(C)c2ccccc2C)cn1 |
| InChI | InChI=1S/C17H23N3/c1-4-11-18-17-10-9-15(12-19-17)13-20(3)16-8-6-5-7-14(16)2/h5-10,12H,4,11,13H2,1-3H3,(H,18,19) |
| InChIKey | WCOARMLCDHULBM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |