About 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one
3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 62209726) has the molecular formula C10H14N4OS
and a molecular weight of 238.32 g/mol. Its IUPAC name is 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| PubChem CID | 62209726 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1nn(C)c(N)c1Cn1c(C)csc1=O |
| InChI | InChI=1S/C10H14N4OS/c1-6-5-16-10(15)14(6)4-8-7(2)12-13(3)9(8)11/h5H,4,11H2,1-3H3 |
| InChIKey | JCLXBPUUOVBUSB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one (CID 62209726) is 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one is Cc1nn(C)c(N)c1Cn1c(C)csc1=O.
What is the InChIKey of 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The InChIKey is JCLXBPUUOVBUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4OS/c1-6-5-16-10(15)14(6)4-8-7(2)12-13(3)9(8)11/h5H,4,11H2,1-3H3.
What are the key properties of 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one?
3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one has a molecular weight of 238.32 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-dimethylpyrazol-4-yl)methyl]-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 62209726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).