About 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile
4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile (PubChem CID 622114) has the molecular formula C13H10N6O
and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile |
| PubChem CID | 622114 |
| Molecular Formula | C13H10N6O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile |
| SMILES | [H]/N=c1\c(C#N)c(N)c(C#N)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H10N6O/c1-20-9-4-2-8(3-5-9)19-13(17)10(6-14)12(16)11(7-15)18-19/h2-5,17H,16H2,1H3/b17-13+ |
| InChIKey | PRHZESQQQVROQZ-GHRIWEEISA-N |
| XLogP | 0.69 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile?
The IUPAC name of 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile (CID 622114) is 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile.
What is the SMILES notation for 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile?
The canonical SMILES for 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile is [H]/N=c1\c(C#N)c(N)c(C#N)nn1-c1ccc(OC)cc1.
What is the InChIKey of 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile?
The InChIKey is PRHZESQQQVROQZ-GHRIWEEISA-N. The full InChI is InChI=1S/C13H10N6O/c1-20-9-4-2-8(3-5-9)19-13(17)10(6-14)12(16)11(7-15)18-19/h2-5,17H,16H2,1H3/b17-13+.
What are the key properties of 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile?
4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile has a molecular weight of 266.26 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-imino-1-(4-methoxyphenyl)pyridazine-3,5-dicarbonitrile is sourced from PubChem (CID 622114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).