C25H20N2O6 — CID 6221147
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6221147) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6221147 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C25H20N2O6/c1-31-18-7-4-16(5-8-18)22-21(23(28)17-6-9-19-20(11-17)33-14-32-19)24(29)25(30)27(22)13-15-3-2-10-26-12-15/h2-12,22,28H,13-14H2,1H3/b23-21+ |
| InChIKey | RCUJYHPRYVQEMB-XTQSDGFTSA-N |
| XLogP | 3.44 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|