C15H24N2OS — CID 62212619
3-piperidin-2-yl-N-(1-thiophen-2-ylpropan-2-yl)propanamide (PubChem CID 62212619) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 3-piperidin-2-yl-N-(1-thiophen-2-ylpropan-2-yl)propanamide.
| Compound Name | 3-piperidin-2-yl-N-(1-thiophen-2-ylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 62212619 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-piperidin-2-yl-N-(1-thiophen-2-ylpropan-2-yl)propanamide |
| SMILES | CC(Cc1cccs1)NC(=O)CCC1CCCCN1 |
| InChI | InChI=1S/C15H24N2OS/c1-12(11-14-6-4-10-19-14)17-15(18)8-7-13-5-2-3-9-16-13/h4,6,10,12-13,16H,2-3,5,7-9,11H2,1H3,(H,17,18) |
| InChIKey | IXNJQWLPNVAWKY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |