C17H26N2O2 — CID 62215094
N-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide (PubChem CID 62215094) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 62215094 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-[2-(3-methylbutoxy)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
| SMILES | CC(C)CCOCCNC(=O)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C17H26N2O2/c1-13(2)8-11-21-12-10-19-17(20)15-7-3-5-14-6-4-9-18-16(14)15/h3,5,7,13,18H,4,6,8-12H2,1-2H3,(H,19,20) |
| InChIKey | ZWWSRINAUFAATH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|