About 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine
4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine (PubChem CID 62216884) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine.
Molecular Properties
| Compound Name | 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine |
| PubChem CID | 62216884 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine |
| SMILES | c1n[nH]c(CCC2CCNCC2)n1 |
| InChI | InChI=1S/C9H16N4/c1(2-9-11-7-12-13-9)8-3-5-10-6-4-8/h7-8,10H,1-6H2,(H,11,12,13) |
| InChIKey | RWMGAHIYNNJFLF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine?
The IUPAC name of 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine (CID 62216884) is 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine.
What is the SMILES notation for 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine?
The canonical SMILES for 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine is c1n[nH]c(CCC2CCNCC2)n1.
What is the InChIKey of 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine?
The InChIKey is RWMGAHIYNNJFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1(2-9-11-7-12-13-9)8-3-5-10-6-4-8/h7-8,10H,1-6H2,(H,11,12,13).
What are the key properties of 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine?
4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine has a molecular weight of 180.25 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine is sourced from PubChem (CID 62216884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).