C8H12N4 — CID 62221599
2-[2-(methylaminomethyl)imidazol-1-yl]propanenitrile (PubChem CID 62221599) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-[2-(methylaminomethyl)imidazol-1-yl]propanenitrile.
| Compound Name | 2-[2-(methylaminomethyl)imidazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 62221599 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-[2-(methylaminomethyl)imidazol-1-yl]propanenitrile |
| SMILES | CNCc1nccn1C(C)C#N |
| InChI | InChI=1S/C8H12N4/c1-7(5-9)12-4-3-11-8(12)6-10-2/h3-4,7,10H,6H2,1-2H3 |
| InChIKey | SBVWMTMQFMZQPZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |