About N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine
N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine (PubChem CID 62222506) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine |
| PubChem CID | 62222506 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nccn1Cc1ncon1 |
| InChI | InChI=1S/C9H13N5O/c1-2-10-5-9-11-3-4-14(9)6-8-12-7-15-13-8/h3-4,7,10H,2,5-6H2,1H3 |
| InChIKey | FRVCYFYKWLWMHX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine?
The IUPAC name of N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine (CID 62222506) is N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine is CCNCc1nccn1Cc1ncon1.
What is the InChIKey of N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine?
The InChIKey is FRVCYFYKWLWMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-2-10-5-9-11-3-4-14(9)6-8-12-7-15-13-8/h3-4,7,10H,2,5-6H2,1H3.
What are the key properties of N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine?
N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine has a molecular weight of 207.24 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(1,2,4-oxadiazol-3-ylmethyl)imidazol-2-yl]methyl]ethanamine is sourced from PubChem (CID 62222506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).