C10H15N3O3 — CID 62222811
2-(2-formylimidazol-1-yl)-N-(3-methoxypropyl)acetamide (PubChem CID 62222811) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(2-formylimidazol-1-yl)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2-formylimidazol-1-yl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 62222811 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-(2-formylimidazol-1-yl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1ccnc1C=O |
| InChI | InChI=1S/C10H15N3O3/c1-16-6-2-3-12-10(15)7-13-5-4-11-9(13)8-14/h4-5,8H,2-3,6-7H2,1H3,(H,12,15) |
| InChIKey | BWOBWGAJOISQTQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|