About 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine
3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine (PubChem CID 62224312) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine.
Molecular Properties
| Compound Name | 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine |
| PubChem CID | 62224312 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine |
| SMILES | COc1cc(OC)cc(-c2nc(C)n(C3CC3)c2N)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-9-17-14(15(16)18(9)11-4-5-11)10-6-12(19-2)8-13(7-10)20-3/h6-8,11H,4-5,16H2,1-3H3 |
| InChIKey | RVBITTHCXRPQKI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine?
The IUPAC name of 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine (CID 62224312) is 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine.
What is the SMILES notation for 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine?
The canonical SMILES for 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine is COc1cc(OC)cc(-c2nc(C)n(C3CC3)c2N)c1.
What is the InChIKey of 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine?
The InChIKey is RVBITTHCXRPQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-9-17-14(15(16)18(9)11-4-5-11)10-6-12(19-2)8-13(7-10)20-3/h6-8,11H,4-5,16H2,1-3H3.
What are the key properties of 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine?
3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine has a molecular weight of 273.34 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-5-(3,5-dimethoxyphenyl)-2-methylimidazol-4-amine is sourced from PubChem (CID 62224312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).