C12H14F7NO3 — CID 622261
propyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate (PubChem CID 622261) has the molecular formula C12H14F7NO3 and a molecular weight of 353.23 g/mol. Its IUPAC name is propyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate.
| Compound Name | propyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 622261 |
| Molecular Formula | C12H14F7NO3 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | propyl 1-(2,2,3,3,4,4,4-heptafluorobutanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCOC(=O)C1CCCN1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F7NO3/c1-2-6-23-8(21)7-4-3-5-20(7)9(22)10(13,14)11(15,16)12(17,18)19/h7H,2-6H2,1H3 |
| InChIKey | GRNGDZUDZHGQAW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|