C15H18F3N3 — CID 62226776
2-ethyl-3-propyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-amine (PubChem CID 62226776) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-ethyl-3-propyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-amine.
| Compound Name | 2-ethyl-3-propyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-amine |
|---|---|
| PubChem CID | 62226776 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-ethyl-3-propyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-amine |
| SMILES | CCCn1c(CC)nc(-c2cccc(C(F)(F)F)c2)c1N |
| InChI | InChI=1S/C15H18F3N3/c1-3-8-21-12(4-2)20-13(14(21)19)10-6-5-7-11(9-10)15(16,17)18/h5-7,9H,3-4,8,19H2,1-2H3 |
| InChIKey | YPOMNKBUQMZYSJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |