C11H18ClNO2 — CID 62227239
1-(6-chlorohexyl)-3-methylpyrrolidine-2,5-dione (PubChem CID 62227239) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is 1-(6-chlorohexyl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-(6-chlorohexyl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 62227239 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(6-chlorohexyl)-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCCCCCCl)C1=O |
| InChI | InChI=1S/C11H18ClNO2/c1-9-8-10(14)13(11(9)15)7-5-3-2-4-6-12/h9H,2-8H2,1H3 |
| InChIKey | OBCDZHJXFGJQNX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|