C15H22ClN3O — CID 62227615
N-amino-2-(3-chlorophenoxy)-N'-cyclohexylpropanimidamide (PubChem CID 62227615) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is N-amino-2-(3-chlorophenoxy)-N'-cyclohexylpropanimidamide.
| Compound Name | N-amino-2-(3-chlorophenoxy)-N'-cyclohexylpropanimidamide |
|---|---|
| PubChem CID | 62227615 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-amino-2-(3-chlorophenoxy)-N'-cyclohexylpropanimidamide |
| SMILES | CC(Oc1cccc(Cl)c1)/C(=N/C1CCCCC1)NN |
| InChI | InChI=1S/C15H22ClN3O/c1-11(20-14-9-5-6-12(16)10-14)15(19-17)18-13-7-3-2-4-8-13/h5-6,9-11,13H,2-4,7-8,17H2,1H3,(H,18,19) |
| InChIKey | OMIABSALDXHTCU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|