About 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide
2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide (PubChem CID 62228143) has the molecular formula C16H20F2N2O
and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide |
| PubChem CID | 62228143 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide |
| SMILES | CCCC(C#N)(CCC)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H20F2N2O/c1-3-7-16(11-19,8-4-2)15(21)20-10-12-5-6-13(17)9-14(12)18/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,20,21) |
| InChIKey | SKNMCUHLVGAKOK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide?
The IUPAC name of 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide (CID 62228143) is 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide.
What is the SMILES notation for 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide?
The canonical SMILES for 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide is CCCC(C#N)(CCC)C(=O)NCc1ccc(F)cc1F.
What is the InChIKey of 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide?
The InChIKey is SKNMCUHLVGAKOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N2O/c1-3-7-16(11-19,8-4-2)15(21)20-10-12-5-6-13(17)9-14(12)18/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,20,21).
What are the key properties of 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide?
2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide has a molecular weight of 294.34 g/mol, XLogP of 3.69, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(2,4-difluorophenyl)methyl]-2-propylpentanamide is sourced from PubChem (CID 62228143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).