C15H19ClN2O2 — CID 62228168
2-(3-chlorophenoxy)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone (PubChem CID 62228168) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone.
| Compound Name | 2-(3-chlorophenoxy)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 62228168 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)ethanone |
| SMILES | CC1CC2CNCC2N1C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-10-5-11-7-17-8-14(11)18(10)15(19)9-20-13-4-2-3-12(16)6-13/h2-4,6,10-11,14,17H,5,7-9H2,1H3 |
| InChIKey | YEEGPUIZXXBOTM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |