About 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one
1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one (PubChem CID 62228806) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one.
Molecular Properties
| Compound Name | 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one |
| PubChem CID | 62228806 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1cc(C)n(CCCCCO)c(=O)n1 |
| InChI | InChI=1S/C11H18N2O2/c1-9-8-10(2)13(11(15)12-9)6-4-3-5-7-14/h8,14H,3-7H2,1-2H3 |
| InChIKey | FPOXMMBEKHINDC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one?
The IUPAC name of 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one (CID 62228806) is 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one.
What is the SMILES notation for 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one?
The canonical SMILES for 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one is Cc1cc(C)n(CCCCCO)c(=O)n1.
What is the InChIKey of 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one?
The InChIKey is FPOXMMBEKHINDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-9-8-10(2)13(11(15)12-9)6-4-3-5-7-14/h8,14H,3-7H2,1-2H3.
What are the key properties of 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one?
1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one has a molecular weight of 210.28 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hydroxypentyl)-4,6-dimethylpyrimidin-2-one is sourced from PubChem (CID 62228806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).