About 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol
5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol (PubChem CID 62229360) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol |
| PubChem CID | 62229360 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol |
| SMILES | Cc1nc(C)n(CCCCCO)n1 |
| InChI | InChI=1S/C9H17N3O/c1-8-10-9(2)12(11-8)6-4-3-5-7-13/h13H,3-7H2,1-2H3 |
| InChIKey | JIRNYABVBPHINP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol?
The IUPAC name of 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol (CID 62229360) is 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol.
What is the SMILES notation for 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol?
The canonical SMILES for 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol is Cc1nc(C)n(CCCCCO)n1.
What is the InChIKey of 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol?
The InChIKey is JIRNYABVBPHINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-8-10-9(2)12(11-8)6-4-3-5-7-13/h13H,3-7H2,1-2H3.
What are the key properties of 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol?
5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol has a molecular weight of 183.25 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-1-ol is sourced from PubChem (CID 62229360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).