C13H13Cl2NO3 — CID 62230261
3-[2-(3,4-dichlorophenyl)pyrrolidin-1-yl]-3-oxopropanoic acid (PubChem CID 62230261) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)pyrrolidin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[2-(3,4-dichlorophenyl)pyrrolidin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62230261 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)pyrrolidin-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-4-3-8(6-10(9)15)11-2-1-5-16(11)12(17)7-13(18)19/h3-4,6,11H,1-2,5,7H2,(H,18,19) |
| InChIKey | MMKXJJMVFBGYQJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|