C15H12FNO — CID 62230828
1,3-dihydroisoindol-2-yl-(4-fluorophenyl)methanone (PubChem CID 62230828) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 1,3-dihydroisoindol-2-yl-(4-fluorophenyl)methanone.
| Compound Name | 1,3-dihydroisoindol-2-yl-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 62230828 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1,3-dihydroisoindol-2-yl-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H12FNO/c16-14-7-5-11(6-8-14)15(18)17-9-12-3-1-2-4-13(12)10-17/h1-8H,9-10H2 |
| InChIKey | VCOYVKTVRDKNAE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |