C9H13N3O3 — CID 62232290
3-[2-(1-methylimidazol-2-yl)ethylamino]-3-oxopropanoic acid (PubChem CID 62232290) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-[2-(1-methylimidazol-2-yl)ethylamino]-3-oxopropanoic acid.
| Compound Name | 3-[2-(1-methylimidazol-2-yl)ethylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62232290 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-[2-(1-methylimidazol-2-yl)ethylamino]-3-oxopropanoic acid |
| SMILES | Cn1ccnc1CCNC(=O)CC(=O)O |
| InChI | InChI=1S/C9H13N3O3/c1-12-5-4-10-7(12)2-3-11-8(13)6-9(14)15/h4-5H,2-3,6H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | VOKKWCZBDLQVBJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|