About 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid
5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 62232816) has the molecular formula C7H6F3NO3
and a molecular weight of 209.12 g/mol. Its IUPAC name is 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid.
Analyze 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid (CID 62232816) is 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid is Cc1oc(CC(F)(F)F)nc1C(=O)O.
What is the InChIKey of 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid?
The InChIKey is IMBSUFAZGDNYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO3/c1-3-5(6(12)13)11-4(14-3)2-7(8,9)10/h2H2,1H3,(H,12,13).
What are the key properties of 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid?
5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid has a molecular weight of 209.12 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(2,2,2-trifluoroethyl)-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 62232816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).