About 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid
2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 62233175) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 62233175 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(C2CC2)nc1C(=O)O |
| InChI | InChI=1S/C8H9NO3/c1-4-6(8(10)11)9-7(12-4)5-2-3-5/h5H,2-3H2,1H3,(H,10,11) |
| InChIKey | MCIWPTRDTKMNDP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid (CID 62233175) is 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid is Cc1oc(C2CC2)nc1C(=O)O.
What is the InChIKey of 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid?
The InChIKey is MCIWPTRDTKMNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-4-6(8(10)11)9-7(12-4)5-2-3-5/h5H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid?
2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid has a molecular weight of 167.16 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 62233175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).