About N-ethylpent-4-yn-2-amine
N-ethylpent-4-yn-2-amine (PubChem CID 62233889) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is N-ethylpent-4-yn-2-amine.
Molecular Properties
| Compound Name | N-ethylpent-4-yn-2-amine |
| PubChem CID | 62233889 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N-ethylpent-4-yn-2-amine |
| SMILES | C#CCC(C)NCC |
| InChI | InChI=1S/C7H13N/c1-4-6-7(3)8-5-2/h1,7-8H,5-6H2,2-3H3 |
| InChIKey | TZUYHASGLFKWGQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethylpent-4-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpent-4-yn-2-amine?
The IUPAC name of N-ethylpent-4-yn-2-amine (CID 62233889) is N-ethylpent-4-yn-2-amine.
What is the SMILES notation for N-ethylpent-4-yn-2-amine?
The canonical SMILES for N-ethylpent-4-yn-2-amine is C#CCC(C)NCC.
What is the InChIKey of N-ethylpent-4-yn-2-amine?
The InChIKey is TZUYHASGLFKWGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-4-6-7(3)8-5-2/h1,7-8H,5-6H2,2-3H3.
What are the key properties of N-ethylpent-4-yn-2-amine?
N-ethylpent-4-yn-2-amine has a molecular weight of 111.19 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpent-4-yn-2-amine is sourced from PubChem (CID 62233889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).