C11H16ClN3O2 — CID 62234135
5-chloro-N-(2-ethoxyethyl)-2-hydrazinylbenzamide (PubChem CID 62234135) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-chloro-N-(2-ethoxyethyl)-2-hydrazinylbenzamide.
| Compound Name | 5-chloro-N-(2-ethoxyethyl)-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 62234135 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 5-chloro-N-(2-ethoxyethyl)-2-hydrazinylbenzamide |
| SMILES | CCOCCNC(=O)c1cc(Cl)ccc1NN |
| InChI | InChI=1S/C11H16ClN3O2/c1-2-17-6-5-14-11(16)9-7-8(12)3-4-10(9)15-13/h3-4,7,15H,2,5-6,13H2,1H3,(H,14,16) |
| InChIKey | DOCVHFWPJAFWBN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|