About 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide
6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 62235821) has the molecular formula C8H9F3N4O
and a molecular weight of 234.18 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| PubChem CID | 62235821 |
| Molecular Formula | C8H9F3N4O |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | NNc1cccc(C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F3N4O/c9-8(10,11)4-13-7(16)5-2-1-3-6(14-5)15-12/h1-3H,4,12H2,(H,13,16)(H,14,15) |
| InChIKey | PBMQRVZKEYDYHR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The IUPAC name of 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (CID 62235821) is 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
What is the SMILES notation for 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The canonical SMILES for 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide is NNc1cccc(C(=O)NCC(F)(F)F)n1.
What is the InChIKey of 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The InChIKey is PBMQRVZKEYDYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N4O/c9-8(10,11)4-13-7(16)5-2-1-3-6(14-5)15-12/h1-3H,4,12H2,(H,13,16)(H,14,15).
What are the key properties of 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide has a molecular weight of 234.18 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide is sourced from PubChem (CID 62235821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).