C24H46N2O2 — CID 622369
1-N,2-N-diheptyl-1-N,2-N-dimethylcyclohexane-1,2-dicarboxamide (PubChem CID 622369) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 1-N,2-N-diheptyl-1-N,2-N-dimethylcyclohexane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-diheptyl-1-N,2-N-dimethylcyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 622369 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 1-N,2-N-diheptyl-1-N,2-N-dimethylcyclohexane-1,2-dicarboxamide |
| SMILES | CCCCCCCN(C)C(=O)C1CCCCC1C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C24H46N2O2/c1-5-7-9-11-15-19-25(3)23(27)21-17-13-14-18-22(21)24(28)26(4)20-16-12-10-8-6-2/h21-22H,5-20H2,1-4H3 |
| InChIKey | XHCWRJRASPWLLP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|