C11H17BrN4O2 — CID 62236996
5-bromo-2-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridine-3-carboxamide (PubChem CID 62236996) has the molecular formula C11H17BrN4O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62236996 |
| Molecular Formula | C11H17BrN4O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methylpyridine-3-carboxamide |
| SMILES | COCC(C)N(C)C(=O)c1cc(Br)cnc1NN |
| InChI | InChI=1S/C11H17BrN4O2/c1-7(6-18-3)16(2)11(17)9-4-8(12)5-14-10(9)15-13/h4-5,7H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | LWMAJHBETZLBCO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|