C10H13N7O — CID 62237331
6-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-2-carboxamide (PubChem CID 62237331) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237331 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 6-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cn1cnnc1CNC(=O)c1cccc(NN)n1 |
| InChI | InChI=1S/C10H13N7O/c1-17-6-13-16-9(17)5-12-10(18)7-3-2-4-8(14-7)15-11/h2-4,6H,5,11H2,1H3,(H,12,18)(H,14,15) |
| InChIKey | OOHHPCRQLPHJDM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|