C13H19N3O3 — CID 62238876
6-[[3-(butan-2-ylamino)-3-oxopropyl]amino]pyridine-2-carboxylic acid (PubChem CID 62238876) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 6-[[3-(butan-2-ylamino)-3-oxopropyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[3-(butan-2-ylamino)-3-oxopropyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 62238876 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 6-[[3-(butan-2-ylamino)-3-oxopropyl]amino]pyridine-2-carboxylic acid |
| SMILES | CCC(C)NC(=O)CCNc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H19N3O3/c1-3-9(2)15-12(17)7-8-14-11-6-4-5-10(16-11)13(18)19/h4-6,9H,3,7-8H2,1-2H3,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | FUYBOVLOPMCMRY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |