C9H11N7O — CID 62239696
6-(methylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-carboxamide (PubChem CID 62239696) has the molecular formula C9H11N7O and a molecular weight of 233.24 g/mol. Its IUPAC name is 6-(methylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 6-(methylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62239696 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6-(methylamino)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-carboxamide |
| SMILES | CNc1cccc(C(=O)NCc2nn[nH]n2)n1 |
| InChI | InChI=1S/C9H11N7O/c1-10-7-4-2-3-6(12-7)9(17)11-5-8-13-15-16-14-8/h2-4H,5H2,1H3,(H,10,12)(H,11,17)(H,13,14,15,16) |
| InChIKey | GLGNWUMVYNQNSV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |