6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid

C12H8FNO2S — CID 62240072

IUPAC6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(Sc2ccc(F)cc2)n1
InChIInChI=1S/C12H8FNO2S/c13-8-4-6-9(7-5-8)17-11-3-1-2-10(14-11)12(15)16/h1-7H,(H,15,16)
InChIKeyLFKNFIBWGXEUCA-UHFFFAOYSA-N
MW249.27 g/mol
LogP3.07
Rot. Bonds3

About 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid

6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid (PubChem CID 62240072) has the molecular formula C12H8FNO2S and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid
PubChem CID62240072
Molecular FormulaC12H8FNO2S
Molecular Weight249.27 g/mol
Exact Mass249.03
IUPAC Name6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(Sc2ccc(F)cc2)n1
InChIInChI=1S/C12H8FNO2S/c13-8-4-6-9(7-5-8)17-11-3-1-2-10(14-11)12(15)16/h1-7H,(H,15,16)
InChIKeyLFKNFIBWGXEUCA-UHFFFAOYSA-N
XLogP3.07
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Pyridinecarboxylic acid, 5-(butylthio)-
CID 3052394
6-Fluoropyridine-2-carboxylic acid
CID 226027
5-Cyano-6-[(4-methylphenyl)methylthio]pyridine-2-carboxylic acid
CID 722241
3-Benzoylsulfanylpyridine-2-carboxylic acid
CID 12361733
3-Pyridinecarboxylic acid, 6-methyl-2-(phenylthio)-
CID 809546
6-(2-Methyl-1,3-thiazol-4-yl)pyridine-2-carboxylic acid
CID 44307561
3-Sulfanylpyridine-2,6-dicarboxylic acid
CID 12361214
3-[(4-Fluorobenzoyl)sulfanyl]pyridine-2-carboxylic acid
CID 12361742
6-(Methylsulfanyl)pyridine-2-carboxylic acid
CID 819413
6-Thien-2-ylpyridine-2-carboxylic acid
CID 4739101
6-Methanesulfonylpyridine-2-carboxylic acid
CID 53429615
3-(Ethylsulfanyl)pyridine-2-carboxylic acid
CID 79006954

Frequently Asked Questions

What is the IUPAC name of 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid?
The IUPAC name of 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid (CID 62240072) is 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid.
What is the SMILES notation for 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid?
The canonical SMILES for 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid is O=C(O)c1cccc(Sc2ccc(F)cc2)n1.
What is the InChIKey of 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid?
The InChIKey is LFKNFIBWGXEUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FNO2S/c13-8-4-6-9(7-5-8)17-11-3-1-2-10(14-11)12(15)16/h1-7H,(H,15,16).
What are the key properties of 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid?
6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid has a molecular weight of 249.27 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)sulfanylpyridine-2-carboxylic acid is sourced from PubChem (CID 62240072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).