C13H17N3O2 — CID 62240163
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(6-amino-2-pyridinyl)methanone (PubChem CID 62240163) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(6-amino-2-pyridinyl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(6-amino-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 62240163 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(6-amino-2-pyridinyl)methanone |
| SMILES | Nc1cccc(C(=O)N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C13H17N3O2/c14-12-6-1-3-9(15-12)13(17)16-7-8-18-11-5-2-4-10(11)16/h1,3,6,10-11H,2,4-5,7-8H2,(H2,14,15) |
| InChIKey | XVMPFLUMGKQUBQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |