C14H22N2O2 — CID 62240234
6-(2,4,4-trimethylpentan-2-ylamino)pyridine-2-carboxylic acid (PubChem CID 62240234) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 6-(2,4,4-trimethylpentan-2-ylamino)pyridine-2-carboxylic acid.
| Compound Name | 6-(2,4,4-trimethylpentan-2-ylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 62240234 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 6-(2,4,4-trimethylpentan-2-ylamino)pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)CC(C)(C)Nc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C14H22N2O2/c1-13(2,3)9-14(4,5)16-11-8-6-7-10(15-11)12(17)18/h6-8H,9H2,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | JDUMDAPKNDBXST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |