About (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid
(E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid (PubChem CID 6224181) has the molecular formula C26H22N2O4S
and a molecular weight of 458.54 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid.
Molecular Properties
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid |
| PubChem CID | 6224181 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid |
| SMILES | COc1ccc(C(=O)Nc2cccc(/C=C(\CCC(=O)O)c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C26H22N2O4S/c1-32-21-12-9-18(10-13-21)25(31)27-20-6-4-5-17(16-20)15-19(11-14-24(29)30)26-28-22-7-2-3-8-23(22)33-26/h2-10,12-13,15-16H,11,14H2,1H3,(H,27,31)(H,29,30)/b19-15+ |
| InChIKey | VOYVZKMRCLUBFD-XDJHFCHBSA-N |
| XLogP | 5.96 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid?
The IUPAC name of (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid (CID 6224181) is (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid.
What is the SMILES notation for (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid?
The canonical SMILES for (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid is COc1ccc(C(=O)Nc2cccc(/C=C(\CCC(=O)O)c3nc4ccccc4s3)c2)cc1.
What is the InChIKey of (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid?
The InChIKey is VOYVZKMRCLUBFD-XDJHFCHBSA-N. The full InChI is InChI=1S/C26H22N2O4S/c1-32-21-12-9-18(10-13-21)25(31)27-20-6-4-5-17(16-20)15-19(11-14-24(29)30)26-28-22-7-2-3-8-23(22)33-26/h2-10,12-13,15-16H,11,14H2,1H3,(H,27,31)(H,29,30)/b19-15+.
What are the key properties of (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid?
(E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid has a molecular weight of 458.54 g/mol, XLogP of 5.96, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(1,3-benzothiazol-2-yl)-5-[3-[(4-methoxybenzoyl)amino]phenyl]pent-4-enoic acid is sourced from PubChem (CID 6224181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).