C9H12ClN5O5S — CID 62243070
3-chloro-4-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzamide (PubChem CID 62243070) has the molecular formula C9H12ClN5O5S and a molecular weight of 337.75 g/mol. Its IUPAC name is 3-chloro-4-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 3-chloro-4-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 62243070 |
| Molecular Formula | C9H12ClN5O5S |
| Molecular Weight | 337.75 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-chloro-4-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzamide |
| SMILES | NNc1c(Cl)cc(C(=O)NCCS(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12ClN5O5S/c10-6-3-5(4-7(15(17)18)8(6)14-11)9(16)13-1-2-21(12,19)20/h3-4,14H,1-2,11H2,(H,13,16)(H2,12,19,20) |
| InChIKey | CMDCWQLSYASMQL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.75 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|