C12H17N5O4 — CID 62243608
5-hydrazinyl-2-nitro-N-[2-oxo-2-(propylamino)ethyl]benzamide (PubChem CID 62243608) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-hydrazinyl-2-nitro-N-[2-oxo-2-(propylamino)ethyl]benzamide.
| Compound Name | 5-hydrazinyl-2-nitro-N-[2-oxo-2-(propylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 62243608 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-hydrazinyl-2-nitro-N-[2-oxo-2-(propylamino)ethyl]benzamide |
| SMILES | CCCNC(=O)CNC(=O)c1cc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N5O4/c1-2-5-14-11(18)7-15-12(19)9-6-8(16-13)3-4-10(9)17(20)21/h3-4,6,16H,2,5,7,13H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | QEEVKELJAGNDKP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|