C11H17ClN4O — CID 62243839
5-chloro-6-hydrazinyl-N-(3-methylbutan-2-yl)pyridine-3-carboxamide (PubChem CID 62243839) has the molecular formula C11H17ClN4O and a molecular weight of 256.74 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(3-methylbutan-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(3-methylbutan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62243839 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(3-methylbutan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(C)C(C)NC(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C11H17ClN4O/c1-6(2)7(3)15-11(17)8-4-9(12)10(16-13)14-5-8/h4-7H,13H2,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | SUADGWRLRSAJIZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|