About 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide
3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide (PubChem CID 62243844) has the molecular formula C12H19ClN4O
and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide |
| PubChem CID | 62243844 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide |
| SMILES | CN(CC(C)(C)C)C(=O)c1nc(NN)ccc1Cl |
| InChI | InChI=1S/C12H19ClN4O/c1-12(2,3)7-17(4)11(18)10-8(13)5-6-9(15-10)16-14/h5-6H,7,14H2,1-4H3,(H,15,16) |
| InChIKey | AJSGIDSHPWYSOK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide?
The IUPAC name of 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide (CID 62243844) is 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide?
The canonical SMILES for 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide is CN(CC(C)(C)C)C(=O)c1nc(NN)ccc1Cl.
What is the InChIKey of 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide?
The InChIKey is AJSGIDSHPWYSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN4O/c1-12(2,3)7-17(4)11(18)10-8(13)5-6-9(15-10)16-14/h5-6H,7,14H2,1-4H3,(H,15,16).
What are the key properties of 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide?
3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide has a molecular weight of 270.76 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2-dimethylpropyl)-6-hydrazinyl-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 62243844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).